C8H13N3 — CID 143861779
2-[(3E)-hexa-1,3-dien-3-yl]-1-methylideneguanidine (PubChem CID 143861779) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3-dien-3-yl]-1-methylideneguanidine.
| Compound Name | 2-[(3E)-hexa-1,3-dien-3-yl]-1-methylideneguanidine |
|---|---|
| PubChem CID | 143861779 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | 2-[(3E)-hexa-1,3-dien-3-yl]-1-methylideneguanidine |
| SMILES | C=CC(=C\CC)/N=C(/N)N=C |
| InChI | InChI=1S/C8H13N3/c1-4-6-7(5-2)11-8(9)10-3/h5-6H,2-4H2,1H3,(H2,9,11)/b7-6+ |
| InChIKey | YUEUIYSDTFPGNL-VOTSOKGWSA-N |
| XLogP | 1.48 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|