C12H24N2 — CID 143256335
N'-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]methanimidamide;ethane;methane (PubChem CID 143256335) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N'-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]methanimidamide;ethane;methane.
| Compound Name | N'-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]methanimidamide;ethane;methane |
|---|---|
| PubChem CID | 143256335 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N'-[(3Z)-3,5-dimethylhexa-1,3,5-trien-2-yl]methanimidamide;ethane;methane |
| SMILES | C.C=C(C)/C=C(/C)C(=C)/N=C/N.CC |
| InChI | InChI=1S/C9H14N2.C2H6.CH4/c1-7(2)5-8(3)9(4)11-6-10;1-2;/h5-6H,1,4H2,2-3H3,(H2,10,11);1-2H3;1H4/b8-5-;; |
| InChIKey | WNHZFRWSADIPDR-XTKZWJJBSA-N |
| XLogP | 3.67 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|