C5H11FN2 — CID 118973109
(Z)-N-ethyl-2-fluoroprop-1-ene-1,3-diamine (PubChem CID 118973109) has the molecular formula C5H11FN2 and a molecular weight of 118.15 g/mol. Its IUPAC name is (Z)-N-ethyl-2-fluoroprop-1-ene-1,3-diamine.
| Compound Name | (Z)-N-ethyl-2-fluoroprop-1-ene-1,3-diamine |
|---|---|
| PubChem CID | 118973109 |
| Molecular Formula | C5H11FN2 |
| Molecular Weight | 118.15 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | (Z)-N-ethyl-2-fluoroprop-1-ene-1,3-diamine |
| SMILES | CCN/C=C(\F)CN |
| InChI | InChI=1S/C5H11FN2/c1-2-8-4-5(6)3-7/h4,8H,2-3,7H2,1H3/b5-4- |
| InChIKey | ZVHXGGSONDXFLB-PLNGDYQASA-N |
| XLogP | 0.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.15 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |