C6H13FN2 — CID 155330138
(Z)-1-N-(3-fluoropropyl)prop-1-ene-1,2-diamine (PubChem CID 155330138) has the molecular formula C6H13FN2 and a molecular weight of 132.18 g/mol. Its IUPAC name is (Z)-1-N-(3-fluoropropyl)prop-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-(3-fluoropropyl)prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 155330138 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | (Z)-1-N-(3-fluoropropyl)prop-1-ene-1,2-diamine |
| SMILES | C/C(N)=C/NCCCF |
| InChI | InChI=1S/C6H13FN2/c1-6(8)5-9-4-2-3-7/h5,9H,2-4,8H2,1H3/b6-5- |
| InChIKey | GGQQZOBWDJIGAZ-WAYWQWQTSA-N |
| XLogP | 0.76 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|