C6H13FN2 — CID 146392671
(E)-1-N-ethyl-1-fluoro-2-N-methylprop-1-ene-1,2-diamine (PubChem CID 146392671) has the molecular formula C6H13FN2 and a molecular weight of 132.18 g/mol. Its IUPAC name is (E)-1-N-ethyl-1-fluoro-2-N-methylprop-1-ene-1,2-diamine.
| Compound Name | (E)-1-N-ethyl-1-fluoro-2-N-methylprop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 146392671 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | (E)-1-N-ethyl-1-fluoro-2-N-methylprop-1-ene-1,2-diamine |
| SMILES | CCN/C(F)=C(/C)NC |
| InChI | InChI=1S/C6H13FN2/c1-4-9-6(7)5(2)8-3/h8-9H,4H2,1-3H3/b6-5- |
| InChIKey | QFHNWYABBQBZOJ-WAYWQWQTSA-N |
| XLogP | 0.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|