C6H14N2 — CID 72660473
2-N,3-N-dimethylbut-2-ene-2,3-diamine (PubChem CID 72660473) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-N,3-N-dimethylbut-2-ene-2,3-diamine.
| Compound Name | 2-N,3-N-dimethylbut-2-ene-2,3-diamine |
|---|---|
| PubChem CID | 72660473 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2-N,3-N-dimethylbut-2-ene-2,3-diamine |
| SMILES | CNC(C)=C(C)NC |
| InChI | InChI=1S/C6H14N2/c1-5(7-3)6(2)8-4/h7-8H,1-4H3 |
| InChIKey | LFKWHOQWJZCJAT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |