About (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine
(Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine (PubChem CID 145303680) has the molecular formula C4H8F2N2
and a molecular weight of 122.12 g/mol. Its IUPAC name is (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine.
Analyze (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine?
The IUPAC name of (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine (CID 145303680) is (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine.
What is the SMILES notation for (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine?
The canonical SMILES for (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine is CN/C(=C\N)C(F)F.
What is the InChIKey of (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine?
The InChIKey is HFJVCNXSSIPFEJ-IHWYPQMZSA-N. The full InChI is InChI=1S/C4H8F2N2/c1-8-3(2-7)4(5)6/h2,4,8H,7H2,1H3/b3-2-.
What are the key properties of (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine?
(Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine has a molecular weight of 122.12 g/mol, XLogP of 0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,3-difluoro-2-N-methylprop-1-ene-1,2-diamine is sourced from PubChem (CID 145303680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).