C5H9F2N — CID 126738539
(E)-N-(2,2-difluoroethyl)prop-1-en-1-amine (PubChem CID 126738539) has the molecular formula C5H9F2N and a molecular weight of 121.13 g/mol. Its IUPAC name is (E)-N-(2,2-difluoroethyl)prop-1-en-1-amine.
| Compound Name | (E)-N-(2,2-difluoroethyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 126738539 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | (E)-N-(2,2-difluoroethyl)prop-1-en-1-amine |
| SMILES | C/C=C/NCC(F)F |
| InChI | InChI=1S/C5H9F2N/c1-2-3-8-4-5(6)7/h2-3,5,8H,4H2,1H3/b3-2+ |
| InChIKey | SUCBODOJVCEAAJ-NSCUHMNNSA-N |
| XLogP | 1.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |