C19H18N4O — CID 118975095
1,3-bis[4-(3-methyldiazirin-3-yl)phenyl]propan-1-one (PubChem CID 118975095) has the molecular formula C19H18N4O and a molecular weight of 318.38 g/mol. Its IUPAC name is 1,3-bis[4-(3-methyldiazirin-3-yl)phenyl]propan-1-one.
| Compound Name | 1,3-bis[4-(3-methyldiazirin-3-yl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 118975095 |
| Molecular Formula | C19H18N4O |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1,3-bis[4-(3-methyldiazirin-3-yl)phenyl]propan-1-one |
| SMILES | CC1(c2ccc(CCC(=O)c3ccc(C4(C)N=N4)cc3)cc2)N=N1 |
| InChI | InChI=1S/C19H18N4O/c1-18(20-21-18)15-8-3-13(4-9-15)5-12-17(24)14-6-10-16(11-7-14)19(2)22-23-19/h3-4,6-11H,5,12H2,1-2H3 |
| InChIKey | VPLHUVYNSJRMGT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 66.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |