C22H19N2O5- — CID 11898007
(3aR,4S,9bS)-6-(4-acetamidophenoxy)carbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate (PubChem CID 11898007) has the molecular formula C22H19N2O5- and a molecular weight of 391.40 g/mol. Its IUPAC name is (3aR,4S,9bS)-6-(4-acetamidophenoxy)carbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate.
| Compound Name | (3aR,4S,9bS)-6-(4-acetamidophenoxy)carbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 11898007 |
| Molecular Formula | C22H19N2O5- |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | (3aR,4S,9bS)-6-(4-acetamidophenoxy)carbonyl-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-4-carboxylate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2cccc3c2N[C@H](C(=O)[O-])[C@@H]2CC=C[C@H]32)cc1 |
| InChI | InChI=1S/C22H20N2O5/c1-12(25)23-13-8-10-14(11-9-13)29-22(28)18-7-3-5-16-15-4-2-6-17(15)20(21(26)27)24-19(16)18/h2-5,7-11,15,17,20,24H,6H2,1H3,(H,23,25)(H,26,27)/p-1/t15-,17-,20+/m1/s1 |
| InChIKey | HKXVLOPLFKEVCT-MDYRTPRTSA-M |
| XLogP | 2.07 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|