C19H20N6O2 — CID 118981154
(3S)-1-cyano-N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylimidazo[1,2-a]pyridin-2-yl]pyrrolidine-3-carboxamide (PubChem CID 118981154) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (3S)-1-cyano-N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylimidazo[1,2-a]pyridin-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyano-N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylimidazo[1,2-a]pyridin-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118981154 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3S)-1-cyano-N-[6-(3,5-dimethyl-1,2-oxazol-4-yl)-5-methylimidazo[1,2-a]pyridin-2-yl]pyrrolidine-3-carboxamide |
| SMILES | Cc1noc(C)c1-c1ccc2nc(NC(=O)[C@H]3CCN(C#N)C3)cn2c1C |
| InChI | InChI=1S/C19H20N6O2/c1-11-18(13(3)27-23-11)15-4-5-17-21-16(9-25(17)12(15)2)22-19(26)14-6-7-24(8-14)10-20/h4-5,9,14H,6-8H2,1-3H3,(H,22,26)/t14-/m0/s1 |
| InChIKey | USTRHZPYRHAYEJ-AWEZNQCLSA-N |
| XLogP | 2.66 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|