C17H15N5O2S — CID 118980455
1-cyano-N-[6-(5-methyl-1,2-oxazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 118980455) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 1-cyano-N-[6-(5-methyl-1,2-oxazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-N-[6-(5-methyl-1,2-oxazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118980455 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 1-cyano-N-[6-(5-methyl-1,2-oxazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | Cc1oncc1-c1ccc2nc(NC(=O)C3CCN(C#N)C3)sc2c1 |
| InChI | InChI=1S/C17H15N5O2S/c1-10-13(7-19-24-10)11-2-3-14-15(6-11)25-17(20-14)21-16(23)12-4-5-22(8-12)9-18/h2-3,6-7,12H,4-5,8H2,1H3,(H,20,21,23) |
| InChIKey | GNHDVKIHLVCNGO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|