C18H18N6OS — CID 118980962
1-cyano-N-[7-methyl-6-(1-methylpyrazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide (PubChem CID 118980962) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-cyano-N-[7-methyl-6-(1-methylpyrazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-N-[7-methyl-6-(1-methylpyrazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118980962 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-cyano-N-[7-methyl-6-(1-methylpyrazol-4-yl)-1,3-benzothiazol-2-yl]pyrrolidine-3-carboxamide |
| SMILES | Cc1c(-c2cnn(C)c2)ccc2nc(NC(=O)C3CCN(C#N)C3)sc12 |
| InChI | InChI=1S/C18H18N6OS/c1-11-14(13-7-20-23(2)8-13)3-4-15-16(11)26-18(21-15)22-17(25)12-5-6-24(9-12)10-19/h3-4,7-8,12H,5-6,9H2,1-2H3,(H,21,22,25) |
| InChIKey | AVRRCIBLGKIBGO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|