C11H11Cl3F3NOS — CID 118982021
N-[2-[(3,5-dichlorophenyl)methylsulfanyl]ethyl]-2,2,2-trifluoroacetamide;hydrochloride (PubChem CID 118982021) has the molecular formula C11H11Cl3F3NOS and a molecular weight of 368.64 g/mol. Its IUPAC name is N-[2-[(3,5-dichlorophenyl)methylsulfanyl]ethyl]-2,2,2-trifluoroacetamide;hydrochloride.
| Compound Name | N-[2-[(3,5-dichlorophenyl)methylsulfanyl]ethyl]-2,2,2-trifluoroacetamide;hydrochloride |
|---|---|
| PubChem CID | 118982021 |
| Molecular Formula | C11H11Cl3F3NOS |
| Molecular Weight | 368.64 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | N-[2-[(3,5-dichlorophenyl)methylsulfanyl]ethyl]-2,2,2-trifluoroacetamide;hydrochloride |
| SMILES | Cl.O=C(NCCSCc1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C11H10Cl2F3NOS.ClH/c12-8-3-7(4-9(13)5-8)6-19-2-1-17-10(18)11(14,15)16;/h3-5H,1-2,6H2,(H,17,18);1H |
| InChIKey | FPYBLLLPYLCWLS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|