C19H25NO4 — CID 118982153
[8-(2-acetamidoethyl)-5,6-dihydronaphthalen-2-yl] tert-butyl carbonate (PubChem CID 118982153) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is [8-(2-acetamidoethyl)-5,6-dihydronaphthalen-2-yl] tert-butyl carbonate.
| Compound Name | [8-(2-acetamidoethyl)-5,6-dihydronaphthalen-2-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 118982153 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [8-(2-acetamidoethyl)-5,6-dihydronaphthalen-2-yl] tert-butyl carbonate |
| SMILES | CC(=O)NCCC1=CCCc2ccc(OC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C19H25NO4/c1-13(21)20-11-10-15-7-5-6-14-8-9-16(12-17(14)15)23-18(22)24-19(2,3)4/h7-9,12H,5-6,10-11H2,1-4H3,(H,20,21) |
| InChIKey | LBVCQMZZWZNFQU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|