C19H25N2O5- — CID 11898304
cis-(1S,2R)-2-[[[2-(4-propan-2-ylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 11898304) has the molecular formula C19H25N2O5- and a molecular weight of 361.42 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[[2-(4-propan-2-ylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | cis-(1S,2R)-2-[[[2-(4-propan-2-ylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 11898304 |
| Molecular Formula | C19H25N2O5- |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | cis-(1S,2R)-2-[[[2-(4-propan-2-ylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | CC(C)c1ccc(OCC(=O)NNC(=O)[C@@H]2CCCC[C@@H]2C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H26N2O5/c1-12(2)13-7-9-14(10-8-13)26-11-17(22)20-21-18(23)15-5-3-4-6-16(15)19(24)25/h7-10,12,15-16H,3-6,11H2,1-2H3,(H,20,22)(H,21,23)(H,24,25)/p-1/t15-,16+/m1/s1 |
| InChIKey | WXDFVVZDHCGEJM-CVEARBPZSA-M |
| XLogP | 0.89 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|