C18H22ClN2O5- — CID 4064316
2-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate (PubChem CID 4064316) has the molecular formula C18H22ClN2O5- and a molecular weight of 381.84 g/mol. Its IUPAC name is 2-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate.
| Compound Name | 2-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 4064316 |
| Molecular Formula | C18H22ClN2O5- |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 2-[[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]amino]carbamoyl]cyclohexane-1-carboxylate |
| SMILES | Cc1cc(OCC(=O)NNC(=O)C2CCCCC2C(=O)[O-])cc(C)c1Cl |
| InChI | InChI=1S/C18H23ClN2O5/c1-10-7-12(8-11(2)16(10)19)26-9-15(22)20-21-17(23)13-5-3-4-6-14(13)18(24)25/h7-8,13-14H,3-6,9H2,1-2H3,(H,20,22)(H,21,23)(H,24,25)/p-1 |
| InChIKey | ZSJPUFWHNBMYRG-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|