C38H53NO4 — CID 118983933
(5R,6S,9S,11R,13R,16S,22S,25R,26S)-9,25-dimethyl-7-[2-(2-phenylmethoxyethoxy)ethyl]-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol (PubChem CID 118983933) has the molecular formula C38H53NO4 and a molecular weight of 587.85 g/mol. Its IUPAC name is (5R,6S,9S,11R,13R,16S,22S,25R,26S)-9,25-dimethyl-7-[2-(2-phenylmethoxyethoxy)ethyl]-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol.
| Compound Name | (5R,6S,9S,11R,13R,16S,22S,25R,26S)-9,25-dimethyl-7-[2-(2-phenylmethoxyethoxy)ethyl]-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol |
|---|---|
| PubChem CID | 118983933 |
| Molecular Formula | C38H53NO4 |
| Molecular Weight | 587.85 g/mol |
| Exact Mass | 587.40 |
| IUPAC Name | (5R,6S,9S,11R,13R,16S,22S,25R,26S)-9,25-dimethyl-7-[2-(2-phenylmethoxyethoxy)ethyl]-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol |
| SMILES | C[C@H]1C[C@H]2O[C@@]34CC[C@H]5C6CCC7=C[C@@H](O)CC[C@]7(C)[C@H]6CC56CC63C[C@@H]4[C@@H]2N(CCOCCOCc2ccccc2)C1 |
| InChI | InChI=1S/C38H53NO4/c1-25-18-33-34(39(22-25)14-15-41-16-17-42-23-26-6-4-3-5-7-26)32-21-37-24-36(37)20-31-29(30(36)11-13-38(32,37)43-33)9-8-27-19-28(40)10-12-35(27,31)2/h3-7,19,25,28-34,40H,8-18,20-24H2,1-2H3/t25-,28-,29?,30-,31-,32+,33+,34-,35-,36?,37?,38+/m0/s1 |
| InChIKey | WGAYXEHLIKGRBZ-HHMSHMESSA-N |
| XLogP | 6.39 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|