C30H46ClNO2 — CID 126660120
(2'S,3R,6'R,7aR,10'S)-4-(2-chloroethyl)-3,6,6',11'-tetramethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol (PubChem CID 126660120) has the molecular formula C30H46ClNO2 and a molecular weight of 488.16 g/mol. Its IUPAC name is (2'S,3R,6'R,7aR,10'S)-4-(2-chloroethyl)-3,6,6',11'-tetramethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol.
| Compound Name | (2'S,3R,6'R,7aR,10'S)-4-(2-chloroethyl)-3,6,6',11'-tetramethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol |
|---|---|
| PubChem CID | 126660120 |
| Molecular Formula | C30H46ClNO2 |
| Molecular Weight | 488.16 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | (2'S,3R,6'R,7aR,10'S)-4-(2-chloroethyl)-3,6,6',11'-tetramethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol |
| SMILES | CC1C[C@H]2OC3(CC[C@H]4C5CC=C6CC(O)CCC6(C)[C@H]5CC45C[C@]53C)[C@H](C)C2N(CCCl)C1 |
| InChI | InChI=1S/C30H46ClNO2/c1-18-13-25-26(32(16-18)12-11-31)19(2)30(34-25)10-8-23-22-6-5-20-14-21(33)7-9-27(20,3)24(22)15-29(23)17-28(29,30)4/h5,18-19,21-26,33H,6-17H2,1-4H3/t18?,19-,21?,22?,23+,24+,25-,26?,27?,28-,29?,30?/m1/s1 |
| InChIKey | UITIRYGCZOWZFA-XNOSKTKGSA-N |
| XLogP | 6.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.16 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|