C29H44O3 — CID 163714503
(1'R,2R,2'S,3S,3aR,6S,7aR,10'S,11'R)-3,3a,6,6',11'-pentamethylspiro[5,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol (PubChem CID 163714503) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is (1'R,2R,2'S,3S,3aR,6S,7aR,10'S,11'R)-3,3a,6,6',11'-pentamethylspiro[5,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol.
| Compound Name | (1'R,2R,2'S,3S,3aR,6S,7aR,10'S,11'R)-3,3a,6,6',11'-pentamethylspiro[5,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol |
|---|---|
| PubChem CID | 163714503 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (1'R,2R,2'S,3S,3aR,6S,7aR,10'S,11'R)-3,3a,6,6',11'-pentamethylspiro[5,6,7,7a-tetrahydro-3H-furo[3,2-b]pyran-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol |
| SMILES | C[C@@H]1CO[C@]2(C)[C@@H](C)[C@@]3(CC[C@H]4[C@@H]5CC=C6CC(O)CC[C@]6(C)[C@H]5CC45CC53C)O[C@@H]2C1 |
| InChI | InChI=1S/C29H44O3/c1-17-12-24-27(5,31-15-17)18(2)29(32-24)11-9-22-21-7-6-19-13-20(30)8-10-25(19,3)23(21)14-28(22)16-26(28,29)4/h6,17-18,20-24,30H,7-16H2,1-5H3/t17-,18+,20?,21-,22-,23-,24+,25-,26?,27+,28?,29+/m0/s1 |
| InChIKey | KMDVBDWYFBRGAE-DOEYROJGSA-N |
| XLogP | 5.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|