C29H45NO2 — CID 58885140
(1'R,2R,2'S,3R,3aS,6S,7aR,10'S,11'R,14'S)-3,4,6,6',11'-pentamethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol (PubChem CID 58885140) has the molecular formula C29H45NO2 and a molecular weight of 439.68 g/mol. Its IUPAC name is (1'R,2R,2'S,3R,3aS,6S,7aR,10'S,11'R,14'S)-3,4,6,6',11'-pentamethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol.
| Compound Name | (1'R,2R,2'S,3R,3aS,6S,7aR,10'S,11'R,14'S)-3,4,6,6',11'-pentamethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol |
|---|---|
| PubChem CID | 58885140 |
| Molecular Formula | C29H45NO2 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.35 |
| IUPAC Name | (1'R,2R,2'S,3R,3aS,6S,7aR,10'S,11'R,14'S)-3,4,6,6',11'-pentamethylspiro[3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine-2,5'-pentacyclo[8.8.0.02,8.06,8.011,16]octadec-16-ene]-14'-ol |
| SMILES | C[C@H]1C[C@H]2O[C@]3(CC[C@H]4[C@@H]5CC=C6C[C@@H](O)CC[C@]6(C)[C@H]5CC45CC53C)[C@H](C)[C@@H]2N(C)C1 |
| InChI | InChI=1S/C29H45NO2/c1-17-12-24-25(30(5)15-17)18(2)29(32-24)11-9-22-21-7-6-19-13-20(31)8-10-26(19,3)23(21)14-28(22)16-27(28,29)4/h6,17-18,20-25,31H,7-16H2,1-5H3/t17-,18+,20-,21-,22-,23-,24+,25-,26-,27?,28?,29+/m0/s1 |
| InChIKey | FHLOREDOJDIBMB-BSSVMBMDSA-N |
| XLogP | 5.42 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|