C30H46ClNO2 — CID 73048711
4'-(2-chloroethyl)-3',6',11,12b-tetramethylspiro[1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-ol (PubChem CID 73048711) has the molecular formula C30H46ClNO2 and a molecular weight of 488.16 g/mol. Its IUPAC name is 4'-(2-chloroethyl)-3',6',11,12b-tetramethylspiro[1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-ol.
| Compound Name | 4'-(2-chloroethyl)-3',6',11,12b-tetramethylspiro[1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-ol |
|---|---|
| PubChem CID | 73048711 |
| Molecular Formula | C30H46ClNO2 |
| Molecular Weight | 488.16 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 4'-(2-chloroethyl)-3',6',11,12b-tetramethylspiro[1,2,3,4,6,6a,6b,7,8,10,12,12a-dodecahydronaphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-ol |
| SMILES | CC1=C2CC3C(CC=C4CC(O)CCC43C)C2CCC2(C1)OC1CC(C)CN(CCCl)C1C2C |
| InChI | InChI=1S/C30H46ClNO2/c1-18-13-27-28(32(17-18)12-11-31)20(3)30(34-27)10-8-23-24-6-5-21-14-22(33)7-9-29(21,4)26(24)15-25(23)19(2)16-30/h5,18,20,22-24,26-28,33H,6-17H2,1-4H3 |
| InChIKey | IMFWTCKBQOWDIY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.16 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|