C34H56N2O2 — CID 143831368
(3'R)-4'-[2-(dimethylamino)ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one;ethane (PubChem CID 143831368) has the molecular formula C34H56N2O2 and a molecular weight of 524.83 g/mol. Its IUPAC name is (3'R)-4'-[2-(dimethylamino)ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one;ethane.
| Compound Name | (3'R)-4'-[2-(dimethylamino)ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one;ethane |
|---|---|
| PubChem CID | 143831368 |
| Molecular Formula | C34H56N2O2 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.43 |
| IUPAC Name | (3'R)-4'-[2-(dimethylamino)ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one;ethane |
| SMILES | CC.CC1=C2CC3C(CCC4=CC(=O)CCC43C)C2CCC2(C1)OC1CC(C)CN(CCN(C)C)C1[C@H]2C |
| InChI | InChI=1S/C32H50N2O2.C2H6/c1-20-15-29-30(34(19-20)14-13-33(5)6)22(3)32(36-29)12-10-25-26-8-7-23-16-24(35)9-11-31(23,4)28(26)17-27(25)21(2)18-32;1-2/h16,20,22,25-26,28-30H,7-15,17-19H2,1-6H3;1-2H3/t20?,22-,25?,26?,28?,29?,30?,31?,32?;/m1./s1 |
| InChIKey | KNFUPBLMCJHYNQ-AHADGGFPSA-N |
| XLogP | 6.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|