C35H55NO5 — CID 73019899
4'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one (PubChem CID 73019899) has the molecular formula C35H55NO5 and a molecular weight of 569.83 g/mol. Its IUPAC name is 4'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one.
| Compound Name | 4'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 73019899 |
| Molecular Formula | C35H55NO5 |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.41 |
| IUPAC Name | 4'-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3',6',11,12b-tetramethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
| SMILES | COCCOCCOCCN1CC(C)CC2OC3(CCC4C(=C(C)C3)CC3C4CCC4=CC(=O)CCC43C)C(C)C21 |
| InChI | InChI=1S/C35H55NO5/c1-23-18-32-33(36(22-23)12-13-39-16-17-40-15-14-38-5)25(3)35(41-32)11-9-28-29-7-6-26-19-27(37)8-10-34(26,4)31(29)20-30(28)24(2)21-35/h19,23,25,28-29,31-33H,6-18,20-22H2,1-5H3 |
| InChIKey | PICZWBGVUPMIKD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|