C41H51NO3 — CID 73008197
3',6',11,12b-tetramethyl-4'-[(4-phenoxyphenyl)methyl]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one (PubChem CID 73008197) has the molecular formula C41H51NO3 and a molecular weight of 605.86 g/mol. Its IUPAC name is 3',6',11,12b-tetramethyl-4'-[(4-phenoxyphenyl)methyl]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one.
| Compound Name | 3',6',11,12b-tetramethyl-4'-[(4-phenoxyphenyl)methyl]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 73008197 |
| Molecular Formula | C41H51NO3 |
| Molecular Weight | 605.86 g/mol |
| Exact Mass | 605.39 |
| IUPAC Name | 3',6',11,12b-tetramethyl-4'-[(4-phenoxyphenyl)methyl]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
| SMILES | CC1=C2CC3C(CCC4=CC(=O)CCC43C)C2CCC2(C1)OC1CC(C)CN(Cc3ccc(Oc4ccccc4)cc3)C1C2C |
| InChI | InChI=1S/C41H51NO3/c1-26-20-38-39(42(24-26)25-29-10-13-33(14-11-29)44-32-8-6-5-7-9-32)28(3)41(45-38)19-17-34-35-15-12-30-21-31(43)16-18-40(30,4)37(35)22-36(34)27(2)23-41/h5-11,13-14,21,26,28,34-35,37-39H,12,15-20,22-25H2,1-4H3 |
| InChIKey | ZHYRWIYCDRBZSV-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.86 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|