C29H43NO3 — CID 77419734
4'-(2-hydroxyethyl)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one (PubChem CID 77419734) has the molecular formula C29H43NO3 and a molecular weight of 453.67 g/mol. Its IUPAC name is 4'-(2-hydroxyethyl)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one.
| Compound Name | 4'-(2-hydroxyethyl)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 77419734 |
| Molecular Formula | C29H43NO3 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.32 |
| IUPAC Name | 4'-(2-hydroxyethyl)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyridine]-3-one |
| SMILES | CC1=C2CC3C(CCC4=CC(=O)CCC43C)C2CCC2(C1)OC1CCCN(CCO)C1C2C |
| InChI | InChI=1S/C29H43NO3/c1-18-17-29(19(2)27-26(33-29)5-4-12-30(27)13-14-31)11-9-22-23-7-6-20-15-21(32)8-10-28(20,3)25(23)16-24(18)22/h15,19,22-23,25-27,31H,4-14,16-17H2,1-3H3 |
| InChIKey | FZAWNNIFTNDGGZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|