C29H45NO2 — CID 147180242
(3'R,4'S,6aS,6bS,9S,12aS,12bR)-3',11,12b-trimethyl-4'-[[(2S)-2-methylbutyl]amino]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-oxolane]-3-one (PubChem CID 147180242) has the molecular formula C29H45NO2 and a molecular weight of 439.68 g/mol. Its IUPAC name is (3'R,4'S,6aS,6bS,9S,12aS,12bR)-3',11,12b-trimethyl-4'-[[(2S)-2-methylbutyl]amino]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-oxolane]-3-one.
| Compound Name | (3'R,4'S,6aS,6bS,9S,12aS,12bR)-3',11,12b-trimethyl-4'-[[(2S)-2-methylbutyl]amino]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-oxolane]-3-one |
|---|---|
| PubChem CID | 147180242 |
| Molecular Formula | C29H45NO2 |
| Molecular Weight | 439.68 g/mol |
| Exact Mass | 439.35 |
| IUPAC Name | (3'R,4'S,6aS,6bS,9S,12aS,12bR)-3',11,12b-trimethyl-4'-[[(2S)-2-methylbutyl]amino]spiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-oxolane]-3-one |
| SMILES | CC[C@H](C)CN[C@@H]1CO[C@]2(CC[C@@H]3C(=C(C)C2)C[C@H]2[C@H]3CCC3=CC(=O)CC[C@@]32C)[C@@H]1C |
| InChI | InChI=1S/C29H45NO2/c1-6-18(2)16-30-27-17-32-29(20(27)4)12-10-23-24-8-7-21-13-22(31)9-11-28(21,5)26(24)14-25(23)19(3)15-29/h13,18,20,23-24,26-27,30H,6-12,14-17H2,1-5H3/t18-,20+,23-,24-,26-,27+,28-,29-/m0/s1 |
| InChIKey | BZLMZBWTXWZHQE-PFAFMJOHSA-N |
| XLogP | 6.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|