C27H39NO2 — CID 68736491
(3'R,3'aS,6aS,6bS,7'aR,9S,12aS,12bR)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one (PubChem CID 68736491) has the molecular formula C27H39NO2 and a molecular weight of 409.61 g/mol. Its IUPAC name is (3'R,3'aS,6aS,6bS,7'aR,9S,12aS,12bR)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one.
| Compound Name | (3'R,3'aS,6aS,6bS,7'aR,9S,12aS,12bR)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
|---|---|
| PubChem CID | 68736491 |
| Molecular Formula | C27H39NO2 |
| Molecular Weight | 409.61 g/mol |
| Exact Mass | 409.30 |
| IUPAC Name | (3'R,3'aS,6aS,6bS,7'aR,9S,12aS,12bR)-3',11,12b-trimethylspiro[2,5,6,6a,6b,7,8,10,12,12a-decahydro-1H-naphtho[2,1-a]azulene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-one |
| SMILES | CC1=C2C[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]2CC[C@@]2(C1)O[C@@H]1CCCN[C@H]1[C@H]2C |
| InChI | InChI=1S/C27H39NO2/c1-16-15-27(17(2)25-24(30-27)5-4-12-28-25)11-9-20-21-7-6-18-13-19(29)8-10-26(18,3)23(21)14-22(16)20/h13,17,20-21,23-25,28H,4-12,14-15H2,1-3H3/t17-,20+,21+,23+,24-,25+,26+,27+/m1/s1 |
| InChIKey | CTVQKYBECLKQCS-RRBOPVCYSA-N |
| XLogP | 5.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.61 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|