C29H42ClNO2 — CID 126660108
(5R,9S,11R,13R,16S,17R,22S,25R,26S)-7-(2-chloroethyl)-9,25-dimethyl-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol (PubChem CID 126660108) has the molecular formula C29H42ClNO2 and a molecular weight of 472.11 g/mol. Its IUPAC name is (5R,9S,11R,13R,16S,17R,22S,25R,26S)-7-(2-chloroethyl)-9,25-dimethyl-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol.
| Compound Name | (5R,9S,11R,13R,16S,17R,22S,25R,26S)-7-(2-chloroethyl)-9,25-dimethyl-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol |
|---|---|
| PubChem CID | 126660108 |
| Molecular Formula | C29H42ClNO2 |
| Molecular Weight | 472.11 g/mol |
| Exact Mass | 471.29 |
| IUPAC Name | (5R,9S,11R,13R,16S,17R,22S,25R,26S)-7-(2-chloroethyl)-9,25-dimethyl-12-oxa-7-azaoctacyclo[14.11.0.01,3.03,13.05,13.06,11.017,26.020,25]heptacos-20-en-22-ol |
| SMILES | C[C@H]1C[C@H]2O[C@@]34CC[C@H]5[C@@H]6CCC7=C[C@@H](O)CC[C@]7(C)[C@H]6CC56CC63C[C@@H]4C2N(CCCl)C1 |
| InChI | InChI=1S/C29H42ClNO2/c1-17-11-24-25(31(15-17)10-9-30)23-14-28-16-27(28)13-22-20(21(27)6-8-29(23,28)33-24)4-3-18-12-19(32)5-7-26(18,22)2/h12,17,19-25,32H,3-11,13-16H2,1-2H3/t17-,19-,20-,21-,22-,23+,24+,25?,26-,27?,28?,29+/m0/s1 |
| InChIKey | ADFPTIUOGFBYIH-VLKILTKTSA-N |
| XLogP | 5.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.11 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|