C20H13N3 — CID 118983962
2-(3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile (PubChem CID 118983962) has the molecular formula C20H13N3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-(3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118983962 |
| Molecular Formula | C20H13N3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-(3,4-dihydrocarbazol-9-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1-n1c2c(c3ccccc31)CCC=C2 |
| InChI | InChI=1S/C20H13N3/c21-12-14-6-5-7-15(13-22)20(14)23-18-10-3-1-8-16(18)17-9-2-4-11-19(17)23/h1,3-8,10-11H,2,9H2 |
| InChIKey | TVGKEUOPTJEGJT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |