C38H24N4 — CID 166727336
4-carbazol-9-yl-6-(3,4-dihydrocarbazol-9-yl)-5-phenylbenzene-1,3-dicarbonitrile (PubChem CID 166727336) has the molecular formula C38H24N4 and a molecular weight of 536.64 g/mol. Its IUPAC name is 4-carbazol-9-yl-6-(3,4-dihydrocarbazol-9-yl)-5-phenylbenzene-1,3-dicarbonitrile.
| Compound Name | 4-carbazol-9-yl-6-(3,4-dihydrocarbazol-9-yl)-5-phenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 166727336 |
| Molecular Formula | C38H24N4 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 4-carbazol-9-yl-6-(3,4-dihydrocarbazol-9-yl)-5-phenylbenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(-n2c3ccccc3c3ccccc32)c(-c2ccccc2)c1-n1c2c(c3ccccc31)CCC=C2 |
| InChI | InChI=1S/C38H24N4/c39-23-26-22-27(24-40)38(42-34-20-10-6-16-30(34)31-17-7-11-21-35(31)42)36(25-12-2-1-3-13-25)37(26)41-32-18-8-4-14-28(32)29-15-5-9-19-33(29)41/h1-6,8-16,18-22H,7,17H2 |
| InChIKey | UIWOLGARFXKNSQ-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |