C32H49NO5 — CID 118985594
4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(2,5-dimethoxyphenyl)pentanamide (PubChem CID 118985594) has the molecular formula C32H49NO5 and a molecular weight of 527.75 g/mol. Its IUPAC name is 4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(2,5-dimethoxyphenyl)pentanamide.
| Compound Name | 4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(2,5-dimethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 118985594 |
| Molecular Formula | C32H49NO5 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.36 |
| IUPAC Name | 4-(3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)-N-(2,5-dimethoxyphenyl)pentanamide |
| SMILES | COc1ccc(OC)c(NC(=O)CCC(C)C2CCC3C4C(O)CC5CC(O)CCC5(C)C4CCC23C)c1 |
| InChI | InChI=1S/C32H49NO5/c1-19(6-11-29(36)33-26-18-22(37-4)7-10-28(26)38-5)23-8-9-24-30-25(13-15-32(23,24)3)31(2)14-12-21(34)16-20(31)17-27(30)35/h7,10,18-21,23-25,27,30,34-35H,6,8-9,11-17H2,1-5H3,(H,33,36) |
| InChIKey | WDOTUPMCBRTHQJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |