C29H49NO5 — CID 142613592
methyl 4-[[(4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate (PubChem CID 142613592) has the molecular formula C29H49NO5 and a molecular weight of 491.71 g/mol. Its IUPAC name is methyl 4-[[(4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate.
| Compound Name | methyl 4-[[(4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate |
|---|---|
| PubChem CID | 142613592 |
| Molecular Formula | C29H49NO5 |
| Molecular Weight | 491.71 g/mol |
| Exact Mass | 491.36 |
| IUPAC Name | methyl 4-[[(4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C29H49NO5/c1-18(7-10-25(33)30-15-5-6-26(34)35-4)21-8-9-22-27-23(12-14-29(21,22)3)28(2)13-11-20(31)16-19(28)17-24(27)32/h18-24,27,31-32H,5-17H2,1-4H3,(H,30,33)/t18-,19+,20-,21-,22+,23+,24?,27+,28+,29-/m1/s1 |
| InChIKey | RFSVIDGCKNBFMP-MLJQZUHVSA-N |
| XLogP | 4.46 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|