C25H37N3O5 — CID 118987596
tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]-1,3-diazinane-1-carboxylate (PubChem CID 118987596) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]-1,3-diazinane-1-carboxylate.
| Compound Name | tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]-1,3-diazinane-1-carboxylate |
|---|---|
| PubChem CID | 118987596 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tert-butyl 5-methyl-2,4-dioxo-3-[[4-(3-piperidin-1-ylpropoxy)phenyl]methyl]-1,3-diazinane-1-carboxylate |
| SMILES | CC1CN(C(=O)OC(C)(C)C)C(=O)N(Cc2ccc(OCCCN3CCCCC3)cc2)C1=O |
| InChI | InChI=1S/C25H37N3O5/c1-19-17-28(24(31)33-25(2,3)4)23(30)27(22(19)29)18-20-9-11-21(12-10-20)32-16-8-15-26-13-6-5-7-14-26/h9-12,19H,5-8,13-18H2,1-4H3 |
| InChIKey | CWMKRWUSXMGLHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|