C32H32FN5O5 — CID 118987769
N-[(3Z)-3-[[3,5-dimethyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-5-(4-fluorophenyl)-4-oxopiperidine-3-carboxamide (PubChem CID 118987769) has the molecular formula C32H32FN5O5 and a molecular weight of 585.64 g/mol. Its IUPAC name is N-[(3Z)-3-[[3,5-dimethyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-5-(4-fluorophenyl)-4-oxopiperidine-3-carboxamide.
| Compound Name | N-[(3Z)-3-[[3,5-dimethyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-5-(4-fluorophenyl)-4-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 118987769 |
| Molecular Formula | C32H32FN5O5 |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | N-[(3Z)-3-[[3,5-dimethyl-4-(morpholine-4-carbonyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-6-yl]-5-(4-fluorophenyl)-4-oxopiperidine-3-carboxamide |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3cc(NC(=O)C4CNCC(c5ccc(F)cc5)C4=O)ccc32)c(C)c1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C32H32FN5O5/c1-17-26(35-18(2)28(17)32(42)38-9-11-43-12-10-38)14-23-22-8-7-21(13-27(22)37-30(23)40)36-31(41)25-16-34-15-24(29(25)39)19-3-5-20(33)6-4-19/h3-8,13-14,24-25,34-35H,9-12,15-16H2,1-2H3,(H,36,41)(H,37,40)/b23-14- |
| InChIKey | FXWIUPCNKYHXMK-UCQKPKSFSA-N |
| XLogP | 3.25 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|