C9H9F2N3 — CID 118990572
2-[6-amino-5-(difluoromethyl)-4-methyl-3-pyridinyl]acetonitrile (PubChem CID 118990572) has the molecular formula C9H9F2N3 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-[6-amino-5-(difluoromethyl)-4-methyl-3-pyridinyl]acetonitrile.
| Compound Name | 2-[6-amino-5-(difluoromethyl)-4-methyl-3-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118990572 |
| Molecular Formula | C9H9F2N3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-[6-amino-5-(difluoromethyl)-4-methyl-3-pyridinyl]acetonitrile |
| SMILES | Cc1c(CC#N)cnc(N)c1C(F)F |
| InChI | InChI=1S/C9H9F2N3/c1-5-6(2-3-12)4-14-9(13)7(5)8(10)11/h4,8H,2H2,1H3,(H2,13,14) |
| InChIKey | NCBIAHRCTCBTBJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |