C9H9F2N3O — CID 118991234
2-[6-amino-4-(difluoromethyl)-5-methoxy-2-pyridinyl]acetonitrile (PubChem CID 118991234) has the molecular formula C9H9F2N3O and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[6-amino-4-(difluoromethyl)-5-methoxy-2-pyridinyl]acetonitrile.
| Compound Name | 2-[6-amino-4-(difluoromethyl)-5-methoxy-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 118991234 |
| Molecular Formula | C9H9F2N3O |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-[6-amino-4-(difluoromethyl)-5-methoxy-2-pyridinyl]acetonitrile |
| SMILES | COc1c(C(F)F)cc(CC#N)nc1N |
| InChI | InChI=1S/C9H9F2N3O/c1-15-7-6(8(10)11)4-5(2-3-12)14-9(7)13/h4,8H,2H2,1H3,(H2,13,14) |
| InChIKey | YFUZRGIHLBXZKU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |