C10H10N2O — CID 118992183
3,7-dimethyl-2H-indazole-4-carbaldehyde (PubChem CID 118992183) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 3,7-dimethyl-2H-indazole-4-carbaldehyde.
| Compound Name | 3,7-dimethyl-2H-indazole-4-carbaldehyde |
|---|---|
| PubChem CID | 118992183 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3,7-dimethyl-2H-indazole-4-carbaldehyde |
| SMILES | Cc1ccc(C=O)c2c(C)[nH]nc12 |
| InChI | InChI=1S/C10H10N2O/c1-6-3-4-8(5-13)9-7(2)11-12-10(6)9/h3-5H,1-2H3,(H,11,12) |
| InChIKey | DLHBPQBYPFSVST-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|