C7H4F3N3O2S — CID 118993918
2-cyano-3-(difluoromethyl)-6-fluoropyridine-4-sulfonamide (PubChem CID 118993918) has the molecular formula C7H4F3N3O2S and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-cyano-3-(difluoromethyl)-6-fluoropyridine-4-sulfonamide.
| Compound Name | 2-cyano-3-(difluoromethyl)-6-fluoropyridine-4-sulfonamide |
|---|---|
| PubChem CID | 118993918 |
| Molecular Formula | C7H4F3N3O2S |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-cyano-3-(difluoromethyl)-6-fluoropyridine-4-sulfonamide |
| SMILES | N#Cc1nc(F)cc(S(N)(=O)=O)c1C(F)F |
| InChI | InChI=1S/C7H4F3N3O2S/c8-5-1-4(16(12,14)15)6(7(9)10)3(2-11)13-5/h1,7H,(H2,12,14,15) |
| InChIKey | RDVYOPHMNZNULO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|