C7H6F2N4O2S — CID 130103775
5-amino-2-cyano-6-(difluoromethyl)pyridine-3-sulfonamide (PubChem CID 130103775) has the molecular formula C7H6F2N4O2S and a molecular weight of 248.21 g/mol. Its IUPAC name is 5-amino-2-cyano-6-(difluoromethyl)pyridine-3-sulfonamide.
| Compound Name | 5-amino-2-cyano-6-(difluoromethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 130103775 |
| Molecular Formula | C7H6F2N4O2S |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 5-amino-2-cyano-6-(difluoromethyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1nc(C(F)F)c(N)cc1S(N)(=O)=O |
| InChI | InChI=1S/C7H6F2N4O2S/c8-7(9)6-3(11)1-5(16(12,14)15)4(2-10)13-6/h1,7H,11H2,(H2,12,14,15) |
| InChIKey | JTAKSGHRNLBVCP-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 122.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |