About (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride
(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride (PubChem CID 118998031) has the molecular formula C6H12ClNO
and a molecular weight of 149.62 g/mol. Its IUPAC name is (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride |
| PubChem CID | 118998031 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride |
| SMILES | Cl.O[C@@H]1C[C@@H]2CC[C@H]1N2 |
| InChI | InChI=1S/C6H11NO.ClH/c8-6-3-4-1-2-5(6)7-4;/h4-8H,1-3H2;1H/t4-,5+,6+;/m0./s1 |
| InChIKey | YNVTZOIAXSPRQO-FPKZOZHISA-N |
| XLogP | 0.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride?
The IUPAC name of (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride (CID 118998031) is (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride.
What is the SMILES notation for (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride?
The canonical SMILES for (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride is Cl.O[C@@H]1C[C@@H]2CC[C@H]1N2.
What is the InChIKey of (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride?
The InChIKey is YNVTZOIAXSPRQO-FPKZOZHISA-N. The full InChI is InChI=1S/C6H11NO.ClH/c8-6-3-4-1-2-5(6)7-4;/h4-8H,1-3H2;1H/t4-,5+,6+;/m0./s1.
What are the key properties of (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride?
(1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride has a molecular weight of 149.62 g/mol, XLogP of 0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R,4S)-7-azabicyclo[2.2.1]heptan-2-ol;hydrochloride is sourced from PubChem (CID 118998031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).