C12H21NO3S — CID 115048531
2-(1,1-dioxothian-3-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 115048531) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-(1,1-dioxothian-3-yl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 2-(1,1-dioxothian-3-yl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 115048531 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 2-(1,1-dioxothian-3-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | O=S1(=O)CCCC(C2C(O)CC3CCC2N3)C1 |
| InChI | InChI=1S/C12H21NO3S/c14-11-6-9-3-4-10(13-9)12(11)8-2-1-5-17(15,16)7-8/h8-14H,1-7H2 |
| InChIKey | ZRYRAFNEYNGMQH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |