C11H19NO2S — CID 115037462
3-(8-azabicyclo[3.2.1]octan-2-yl)thiolane 1,1-dioxide (PubChem CID 115037462) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is 3-(8-azabicyclo[3.2.1]octan-2-yl)thiolane 1,1-dioxide.
| Compound Name | 3-(8-azabicyclo[3.2.1]octan-2-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 115037462 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-(8-azabicyclo[3.2.1]octan-2-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C2CCC3CCC2N3)C1 |
| InChI | InChI=1S/C11H19NO2S/c13-15(14)6-5-8(7-15)10-3-1-9-2-4-11(10)12-9/h8-12H,1-7H2 |
| InChIKey | NBWNWLFYRHAZOF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |