C13H23ClO2S — CID 55107252
3-(2-chloro-5-propan-2-ylcyclohexyl)thiolane 1,1-dioxide (PubChem CID 55107252) has the molecular formula C13H23ClO2S and a molecular weight of 278.84 g/mol. Its IUPAC name is 3-(2-chloro-5-propan-2-ylcyclohexyl)thiolane 1,1-dioxide.
| Compound Name | 3-(2-chloro-5-propan-2-ylcyclohexyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 55107252 |
| Molecular Formula | C13H23ClO2S |
| Molecular Weight | 278.84 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(2-chloro-5-propan-2-ylcyclohexyl)thiolane 1,1-dioxide |
| SMILES | CC(C)C1CCC(Cl)C(C2CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C13H23ClO2S/c1-9(2)10-3-4-13(14)12(7-10)11-5-6-17(15,16)8-11/h9-13H,3-8H2,1-2H3 |
| InChIKey | HCGGIBCWGSNXRV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.84 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|