C8H10N2O4S2 — CID 7131544
5-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 7131544) has the molecular formula C8H10N2O4S2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 7131544 |
| Molecular Formula | C8H10N2O4S2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 5-[(3R)-1,1-dioxothiolan-3-yl]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H10N2O4S2/c11-6-5(7(12)10-8(15)9-6)4-1-2-16(13,14)3-4/h4-5H,1-3H2,(H2,9,10,11,12,15)/t4-/m0/s1 |
| InChIKey | ZZEKATLNQBNWOE-BYPYZUCNSA-N |
| XLogP | -1.43 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|