C16H23N3O5S2 — CID 42956299
N-cyclohexyl-2-[[5-(1,1-dioxothiolan-3-yl)-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide (PubChem CID 42956299) has the molecular formula C16H23N3O5S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-cyclohexyl-2-[[5-(1,1-dioxothiolan-3-yl)-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide.
| Compound Name | N-cyclohexyl-2-[[5-(1,1-dioxothiolan-3-yl)-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 42956299 |
| Molecular Formula | C16H23N3O5S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-cyclohexyl-2-[[5-(1,1-dioxothiolan-3-yl)-4,6-dioxo-1H-pyrimidin-2-yl]sulfanyl]acetamide |
| SMILES | O=C(CSC1=NC(=O)C(C2CCS(=O)(=O)C2)C(=O)N1)NC1CCCCC1 |
| InChI | InChI=1S/C16H23N3O5S2/c20-12(17-11-4-2-1-3-5-11)8-25-16-18-14(21)13(15(22)19-16)10-6-7-26(23,24)9-10/h10-11,13H,1-9H2,(H,17,20)(H,18,19,21,22) |
| InChIKey | YTLNEZYSTJXKPI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|