C9H14N2O4S — CID 61058278
3-[(1,1-dioxothiolan-3-yl)methylamino]pyrrolidine-2,5-dione (PubChem CID 61058278) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)methylamino]pyrrolidine-2,5-dione.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61058278 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)methylamino]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCC2CCS(=O)(=O)C2)C(=O)N1 |
| InChI | InChI=1S/C9H14N2O4S/c12-8-3-7(9(13)11-8)10-4-6-1-2-16(14,15)5-6/h6-7,10H,1-5H2,(H,11,12,13) |
| InChIKey | CCQZALLRLOKBSD-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|