C12H19NO3S — CID 115048078
2-(1,1-dioxothian-4-yl)-8-azabicyclo[3.2.1]octan-3-one (PubChem CID 115048078) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-8-azabicyclo[3.2.1]octan-3-one.
| Compound Name | 2-(1,1-dioxothian-4-yl)-8-azabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 115048078 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-8-azabicyclo[3.2.1]octan-3-one |
| SMILES | O=C1CC2CCC(N2)C1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H19NO3S/c14-11-7-9-1-2-10(13-9)12(11)8-3-5-17(15,16)6-4-8/h8-10,12-13H,1-7H2 |
| InChIKey | VOQOHTQXRCXKNN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |