C7H12N2O — CID 134159257
(6S)-3,9-diazabicyclo[4.2.1]nonan-4-one (PubChem CID 134159257) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (6S)-3,9-diazabicyclo[4.2.1]nonan-4-one.
| Compound Name | (6S)-3,9-diazabicyclo[4.2.1]nonan-4-one |
|---|---|
| PubChem CID | 134159257 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (6S)-3,9-diazabicyclo[4.2.1]nonan-4-one |
| SMILES | O=C1C[C@@H]2CCC(CN1)N2 |
| InChI | InChI=1S/C7H12N2O/c10-7-3-5-1-2-6(9-5)4-8-7/h5-6,9H,1-4H2,(H,8,10)/t5-,6?/m0/s1 |
| InChIKey | OJDDWFBNQVXOPZ-ZBHICJROSA-N |
| XLogP | -0.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |