C11H17NO3S — CID 168685133
1-(1,1-dioxothian-4-yl)-4-ethenylpyrrolidin-2-one (PubChem CID 168685133) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is 1-(1,1-dioxothian-4-yl)-4-ethenylpyrrolidin-2-one.
| Compound Name | 1-(1,1-dioxothian-4-yl)-4-ethenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168685133 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-(1,1-dioxothian-4-yl)-4-ethenylpyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(C2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C11H17NO3S/c1-2-9-7-11(13)12(8-9)10-3-5-16(14,15)6-4-10/h2,9-10H,1,3-8H2 |
| InChIKey | YLLPXRKNBCVHJT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|